| Cas No.: | 938448-87-4 |
| Chemical Name: | [(4Ar,6R,7R,7aR)-6-[6-(butanoylamino)purin-9-yl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl] butanoate;calcium |
| Synonyms: | Bucladesine calcium;Bucladesine (calciuM salt);DC2797 calcium salt;Dibutyryl-cAMP calcium salt;[(4Ar,6R,7R,7aR)-6-[6-(butanoylamino)purin-9-yl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d];Dibutyryl cAMP calcium salt;DBcAMP calcium salt;Calcium N6-2′-O-dibutyryl cyclic adenosine-3′,5′-monophosphate |
| SMILES: | O([C@@H]1[C@@H]2OP(OC[C@H]2O[C@H]1N1C=NC2C(=NC=NC1=2)NC(=O)CCC)(O)=O)C(=O)CCC.[Ca] |
| Formula: | C18H24CaN5O8P |
| M.Wt: | 509.463624000549 |
| Purity: | >98% |
| Sotrage: | 0°C (short term), -20°C (long term), desiccated |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
