| Cas No.: | 92953-54-3 |
| Chemical Name: | Ethanesulfonic acid,2-[[4-O-[2-(acetylamino)-2-deoxy-4-O-sulfo-b-D-glucopyranosyl]-2,3,5-trideoxy-2,5-imino-D-arabino-hexonoyl]amino]-(9CI) |
| Synonyms: | Ethanesulfonic acid,2-[[4-O-[2-(acetylamino)-2-deoxy-4-O-sulfo-b-D-glucopyranosyl]-2,3,5-trideoxy-2,5-imino-D-arabino-hexonoyl]amino]-(9CI);bulgecin A;DTXSID90869108;bulgecin a;CID 2470;92953-54-3 |
| SMILES: | CC(=O)NC1C(C(C(OC1OC2CC(NC2CO)C(=O)NCCS(=O)(=O)O)CO)OS(=O)(=O)O)O |
| Formula: | C16H29N3O14S2 |
| M.Wt: | 551.54316 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
