| Cas No.: | 15533-09-2 |
| Chemical Name: | Compound C108 |
| Synonyms: | Benzoic acid, 2-hydroxy-, [1-(2-hydroxyphenyl)ethylidene]hydrazide;2-Hydroxy-2-[1-(2-hydroxyphenyl)ethylidene]hydrazide-benzoic acid;2-Hydroxy-N′-[1-(2-hydroxyphenyl)ethylidene]benzohydrazide;Compound C108 |
| SMILES: | OC1=CC=CC=C1/C(=N/NC(=O)C1=CC=CC=C1O)/C |
| Formula: | C15H14N2O3 |
| M.Wt: | 270.283 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
