| Cas No.: | 179248-61-4 |
| Chemical Name: | EGFR/ErbB-2/ErbB-4 inhibitor-2 |
| Synonyms: | 4-Quinazolinamine, 6,7-dimethoxy-N-[4-(phenylmethoxy)phenyl]-;6,7-dimethoxy-N-(4-phenylmethoxyphenyl)quinazolin-4-amine;6,7-Dimethoxy-N-[4-(phenylmethoxy)phenyl]-4-quinazolinamine;EGFR/ErbB-2 Inhibitor;EGFR/ErbB-2/ErbB-4 inhibitor-2 |
| SMILES: | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)OCC4=CC=CC=C4)OC |
| Formula: | C23H21N3O3 |
| M.Wt: | 387.43114 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
