| Cas No.: | 2761063-79-8 |
| Chemical Name: | 3,3'-Bipyridine, 6-[2-(4-fluorophenyl)ethoxy]- |
| SMILES: | FC(C=C1)=CC=C1CCOC(N=C2)=CC=C2C3=CC=CN=C3 |
| Formula: | C18H15FN2O |
| M.Wt: | 294.32 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ELOVL1-IN-2 is an elongation of very long chain fatty acid 1 (ELOVL1) enzyme inhibitor, ELOVL1-IN-2 shows weak ELOVL1 inhibition (IC50=21 μM) and moderate potency in a primary cellular assay (HEK293 C26 IC50=6.7 μM) . |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
