| Cas No.: | 2412089-96-2 |
| Chemical Name: | Fluorofurimazine |
| Synonyms: | Imidazo[1,2-a]pyrazin-3(7H)-one, 6-(3-amino-2-fluorophenyl)-8-[(2-fluorophenyl)methyl]-2-(2-furanylmethyl)-;Fluorofurimazine |
| SMILES: | C12N=C(CC3=CC=CO3)C(=O)N1C=C(C1=CC=CC(N)=C1F)NC=2CC1=CC=CC=C1F |
| Formula: | C24H18F2N4O2 |
| M.Wt: | 432.422132015228 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
