| Cas No.: | 21150-23-2 |
| Chemical Name: | γ-Amanitin |
| SMILES: | O=[S](C[C@H](NC(CNC1=O)=O)C(N[C@H](C2=O)CC(N)=O)=O)C(N3)=C(C[C@@H](C(NCC(N[C@H]1[C@@H](C)CC)=O)=O)NC([C@@H](NC([C@H](C4)N2C[C@@H]4O)=O)[C@@H](C)[C@@H](O)C)=O)C(C3=C5)=CC=C5O |
| Formula: | C39H54N10O13S |
| M.Wt: | 902.97 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Description: | γ-Amanitin an ADC cytotoxin and isolated from the?mushroom. γ-Amanitin inhibits?RNA polymerase II and disrupts synthesis of?mRNA. γ-Amanitin shows similar effects to α-Amanitin and β-Amanitin . |
| Target: | Traditional Cytotoxic Agents |
| References: | [1]. Gamma-Amanitin |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
