| Cas No.: | 1316059-00-3 |
| Chemical Name: | GSK854 |
| Synonyms: | GSK854;3-((6-((5-Chloropyridin-2-yl)amino)pyrimidin-4-yl)amino)-4-(ethylsulfonyl)-N-methylbenzenesulfonamide;3-[6-(5-Chloro-pyridin-2-ylamino)-pyrimidin-4-ylamino]-4-ethanesulfonyl-N-methyl-benzenesulfonamide;BDBM50245254;3-[[6-[(5-chloropyridin-2-yl)amino]pyrimidin-4-yl]amino]-4-ethylsulfonyl-N-methylbenzenesulfonamide;1316059-00-3;GSK 854 - Bio-X;CHEMBL4094739;SCHEMBL12516318;BG165704;GLXC-04767;CS-0070048;HY-119608;GSK 854;AKOS027324977 |
| SMILES: | ClC1=CN=C(C=C1)NC1=CC(=NC=N1)NC1C=C(C=CC=1S(CC)(=O)=O)S(NC)(=O)=O |
| Formula: | C18H19ClN6O4S2 |
| M.Wt: | 482.964259386063 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
