| Cas No.: | 1394894-41-7 |
| Chemical Name: | 1-Piperazinecarboxamide, 4-((3-(4-chlorophenoxy)phenyl)methyl)-N-3-pyridinyl- |
| Synonyms: | CHEMBL2164602;JNJ40355003;JNJ-40355003;HY-18013;CS-0007150;SCHEMBL1758816;UNII-Z0O8PGE4TB;DA-54546;Q27893050;Z0O8PGE4TB;compound 23 [PMID: 24900385];BDBM50394620;4-(3-(4-Chlorophenoxy)benzyl)-N-(pyridin-3-yl)piperazine-1-carboxamide;1394894-41-7;AKOS040748632;1-Piperazinecarboxamide, 4-((3-(4-chlorophenoxy)phenyl)methyl)-N-3-pyridinyl-;GTPL9050 |
| SMILES: | ClC1C=CC(=CC=1)OC1=CC=CC(=C1)CN1CCN(C(NC2C=NC=CC=2)=O)CC1 |
| Formula: | C23H23ClN4O2 |
| M.Wt: | 422.907324075699 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
