| Cas No.: | 1636878-33-5 |
| Chemical Name: | MBX3132 |
| Synonyms: | Acetamide, N-[4-[2-[[5-cyano-8-(2,6-dimethyl-4-morpholinyl)-3,4-dihydro-3,3-dimethyl-1H-pyrano[3,4-c]pyridin-6-yl]thio]ethyl]phenyl]- |
| SMILES: | C(NC1=CC=C(CCSC2N=C(N3CC(C)OC(C)C3)C3COC(C)(C)CC=3C=2C#N)C=C1)(=O)C |
| Formula: | C27H34N4O3S |
| M.Wt: | 494.648865222931 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
