| Cas No.: | 864716-85-8 |
| Chemical Name: | Mesendogen |
| Synonyms: | Mesendogen;Benzamide, N-[[[2-chloro-5-(trifluoromethyl)phenyl]amino]thioxomethyl]-4-(1-methylethyl)-;N-({[2-Chloro-5-(trifluoromethyl) phenyl]amino}carbonothioyl)-4-isopropylbenzamide;N-({[2-chloro-5-(trifluoromethyl)phenyl]amino}carbonothioyl)-4-isopropylbenzamide |
| SMILES: | ClC1C([H])=C([H])C(C(F)(F)F)=C([H])C=1N([H])C(N([H])C(C1C([H])=C([H])C(=C([H])C=1[H])C([H])(C([H])([H])[H])C([H])([H])[H])=O)=S |
| Formula: | C18H16ClF3N2Os |
| M.Wt: | 400.8457 |
| Purity: | >98% |
| Sotrage: | 0°C (short term), -20°C (long term), desiccated |
| Description: | Novel inhibitor of TRPM6, promoting mesoderm and definitive endoderm differentiation of human embryonic stem cells through alteration of magnesium homeostasis |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
