| Cas No.: | 2108631-19-0 |
| Chemical Name: | N1-methyl-N1-[[4-[4-(1-methylethoxy)phenyl]-1H-pyrrol-3-yl]methyl]-1,2-ethanediamine,trihydrochloride |
| Synonyms: | MS023 (hydrochloride) |
| SMILES: | C(C1=CNC=C1C1C=CC(OC(C)C)=CC=1)N(C)CCN.Cl |
| Formula: | C17H26ClN3O |
| M.Wt: | 323.86084318161 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | MS023 hydrochloride is a potent, selective and cell-active inhibitor of human type I protein arginine methyltransferases (PRMT), with IC50 values of 30, 119, 83, 4 and 5 nM for PRMT1, PRMT3, PRMT4, PRMT6, and PRMT8, respectively. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
