| Cas No.: | 2332820-04-7 |
| Chemical Name: | ACSS2-IN-2 |
| Synonyms: | Benzoic acid, 3-[4-[[[3-(1,1-difluoroethyl)phenyl]amino]carbonyl]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]-, methyl ester;methyl 3-[4-[[3-(1,1-difluoroethyl)phenyl]carbamoyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzoate;MTB-9655;ACSS2-IN-2 |
| SMILES: | FC(C)(C1C=CC=C(C=1)NC(C1C(N(C2C=CC=C(C(=O)OC)C=2)N=C1C)=O)=O)F |
| Formula: | C21H19F2N3O4 |
| M.Wt: | 415.390072107315 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
