| Cas No.: | 2139348-63-1 |
| Chemical Name: | Pomalidomide 4'-PEG5-acid |
| Synonyms: | Pomalidomide-PEG5-CO2H;Pomalidomide 4' PEG5 acid |
| SMILES: | O=C(O)CCOCCOCCOCCOCCOCCNC1=CC=CC(C(N2C(CC3)C(NC3=O)=O)=O)=C1C2=O |
| Formula: | C26H35N3O11 |
| M.Wt: | 565.57 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
