| Cas No.: | 1619884-67-1 |
| Chemical Name: | PSB-1491 |
| Synonyms: | 1H-Indazole-5-carboxamide, N-(3,4-dichlorophenyl)-1-methyl-;PSB 1491;PSB1491;PSB-1491 |
| SMILES: | N1(C)C2=C(C=C(C(NC3=CC=C(Cl)C(Cl)=C3)=O)C=C2)C=N1 |
| Formula: | C15H11Cl2N3O |
| M.Wt: | 320.17 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
