| Cas No.: | |
| Chemical Name: | (R)-PF-04991532 |
| SMILES: | O=C(C1=CC=C(NC([C@H](N2C=C(C(F)(F)F)N=C2)CC3CCCC3)=O)N=C1)O |
| Formula: | C18H19F3N4O3 |
| M.Wt: | 396.36 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | |
| Chemical Name: | (R)-PF-04991532 |
| SMILES: | O=C(C1=CC=C(NC([C@H](N2C=C(C(F)(F)F)N=C2)CC3CCCC3)=O)N=C1)O |
| Formula: | C18H19F3N4O3 |
| M.Wt: | 396.36 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |