| Cas No.: | 247580-43-4 |
| Chemical Name: | methyl (2S)-2-(naphthalene-1-carbonylamino)-3-(4-nitrophenyl)propanoate |
| Synonyms: | (S)-METHYL-2-NAPHTHOYLAMINO-3-(4-NITROPHENYL)PROPIONATE;methyl (2S)-2-(naphthalene-1-carbonylamino)-3-(4-nitrophenyl)propanoate;SB 328437;N-(1-Naphthalenylcarbonyl)-4-nitro-L-phenylalanineMethylester;L-Phenylalanine, N-(1-naphthalenylcarbonyl)-4-nitro-, methyl ester;HMS3414E05;HMS3678E05;BDBM50100021;N-(1-NAPHTHALENYLCARBONYL)-4-NITRO-L-PHENYLALANINE METHYL ESTER;SB 328437, >=98% (HPLC);(S)-2-[(Naphthalene-1-carbonyl)-amino]-3-(4-ni |
| SMILES: | O(C)C([C@H](CC1C=CC(=CC=1)[N+](=O)[O-])N([H])C(C1=CC=CC2=CC=CC=C12)=O)=O |
| Formula: | C21H18N2O5 |
| M.Wt: | 378.378025531769 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
