| Cas No.: | 1150153-86-8 |
| Chemical Name: | SR 16584 |
| Synonyms: | SR 16584;1-[(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indolin-2-one;1,3-Dihydro-1-(3-exo)-9-methyl-9-azabicyclo[3.3.1]non-3-yl]-2H-indol-2-one;1-[(1R,5S)-9-Methyl-9-azabicyclo[3.3.1]nonan-3-yl]-3H-indol-2-one |
| SMILES: | O=C1CC2C=CC=CC=2N1C1C[C@@H]2CCC[C@H](C1)N2C |
| Formula: | C17H22N2O |
| M.Wt: | 270.369384288788 |
| Purity: | >98% |
| Sotrage: | 0°C (short term), -20°C (long term), desiccated |
| Description: | SR 16584 is a selective antagonist of α3β4 nAChR with an IC50 of 10.2 μM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
