| Cas No.: | 1231952-55-8 |
| Chemical Name: | Srt3025 |
| Synonyms: | SRT 3025,SRT-3025 |
| SMILES: | C1C=C(C2SC(CCCOC)=C(C(NC3C=CC=CC=3C3=NC4=C(N=CC(=C4)CN4CCCC4)S3)=O)N=2)C=CC=1.Cl |
| Formula: | C31H32ClN5O2S2 |
| M.Wt: | 606.2 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
