| Cas No.: | |
| Chemical Name: | 1-m-PES |
| Synonyms: | 1-methoxy-5-methylphenazinium ethyl sulfate |
| SMILES: | C1=CC=CC2N=C3C(OC)=CC=CC3=[NH0+](C)C1=2.CCOS(=O)(=O)[OH0-] |
| Formula: | C₂HsO4S(1-)*C14HN,O(1+) |
| M.Wt: | 350.395 |
| Purity: | >90% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
