| Cas No.: | 78842-13-4 |
| Chemical Name: | 2′-Deoxy-2′-fluoroguanosine |
| SMILES: | O=C1C2=C(NC(N)=N1)N([C@]3([H])O[C@@H]([C@H]([C@H]3F)O)CO)C=N2 |
| Formula: | C10H12FN5O4 |
| M.Wt: | 285.23 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 78842-13-4 |
| Chemical Name: | 2′-Deoxy-2′-fluoroguanosine |
| SMILES: | O=C1C2=C(NC(N)=N1)N([C@]3([H])O[C@@H]([C@H]([C@H]3F)O)CO)C=N2 |
| Formula: | C10H12FN5O4 |
| M.Wt: | 285.23 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |