| Cas No.: | 54706-99-9 |
| Chemical Name: | 20-deoxyingenolne |
| Synonyms: | 20-deoxyingenol;(1aR,10aα)-1a,2,5,5a,6,9,10,10a-Octahydro-5β,5aβ,6β-trihydroxy-1,1,4,7,9α-pentamethyl-1H-2α,8aα-methanocyclopenta[a]cyclopropa[e]cyclodecen-11-one;(4S,5S,6R,10R,12R,14R)-4,5,6-Trihydroxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentade;(1S,4S,5S,6R,9R,10R,12R,14R)-4,5,6-trihydroxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]p |
| SMILES: | CC1[C@@H](O)[C@@]2(O)C3(C=C(C)[C@@H]2O)C(=O)C(C=1)[C@@H]4C(C)(C)[C@@H]4C[C@H]3C |
| Formula: | C20H28O4 |
| M.Wt: | 332.4 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | 20-Deoxyingenol is a natural compound. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
