| Cas No.: | 2603-10-3 |
| Chemical Name: | Methyl phenylcarbamate |
| Synonyms: | Carbamic acid,N-phenyl-, methyl ester;Methyl N-Phenylcarbamate;N-PHENYLCARBAMIC ACID METHYL ESTER;Carbamic acid,phenyl-,methyl ester;Carbanilic acid,methyl ester;CH3O-CO-NH-Ph;methoxy-N-benzamide;Methyl carbanilate;methyl N-phenyl-carbamate;Methyl N-phenylurethane;Methyl phenylcarbamate;Methyl phenylurethane;Carbanilic acid, methyl ester;B3L1HPI8NJ;IAGUPODHENSJEZ-UHFFFAOYSA-N;N-phenyl-carbamic acid methyl ester;Carbamic acid, phenyl-, methyl ester;Phenylcarbamic acid methyl;ARONIS27180;IAGUPODHENSJEZ-UHFFFAOYSA-;HMS1721H14;methyl hydrogen phenylimidoc |
| SMILES: | O(C([H])([H])[H])C(N([H])C1C([H])=C([H])C([H])=C([H])C=1[H])=O |
| Formula: | C8H9NO2 |
| M.Wt: | 151.1626 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
