| Cas No.: | 2222635-15-4 |
| Chemical Name: | Dclk1-IN-1 |
| SMILES: | FC(C([H])([H])N1C(C2=C([H])C([H])=C([H])C([H])=C2N(C([H])([H])[H])C2C1=C([H])N=C(N=2)N([H])C1C([H])=C([H])C(=C([H])C=1OC([H])([H])[H])N1C([H])([H])C([H])([H])N(C([H])([H])[H])C([H])([H])C1([H])[H])=O)(F)F |
| Formula: | C26N7O2F3H28 |
| M.Wt: | 527.5414 |
| Purity: | >98% |
| Sotrage: | -20 |
| In Vivo: | DCLK1-IN-1 has a favorable pharmacokinetic profile in mice, with a half-life of 2.09 hours, an area under the curve of 5,506 h/ng ml and 81% oral bioavailability[1]. |
| In Vitro: | DCLK1-IN-1 shows no significant activity against ERK5, ACK, and LRRK2. DCLK1-IN-1 potently binds DCLK1 in HCT116 cells (IC50 = 279 nM). DCLK1-IN-1 significantly inhibited DCLK1, and weakly inhibited ERK5, in PATU-8988T cell lysates and live cells[1]. |
| References: | [1]. Ferguson FM, et al. Discovery of a selective inhibitor of doublecortin like kinase 1. Nat Chem Biol. 2020 Apr 6. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
