| Cas No.: | 2299226-01-8 |
| Chemical Name: | CBP/p300-IN-3 |
| Synonyms: | CBP/p300-IN-3;P300/CBP-IN-3 |
| SMILES: | O=C(C1C=CC2=C(C=1)N=C(C1=CN=C(C=C1)N(CC)CC)N2CC1C=CN(CC)N=1)NC |
| Formula: | C24H29N7O |
| M.Wt: | 431.533364057541 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Medina, et al. 5-(1H-Benzo[d]imidazol-2-yl)pyridin-2-amine and 5-(3H-imidazo[4,5-b]pyridin-6-yl)pyridin-2-amine derivatives as c-MYC and p300/CBP histone acetyltransferase inhibitors for treating cancer and their preparation. |
| Description: | P300/CBP-IN-3, a p300/CBP histone acetyltransferase inhibitor, Compound 6, is sourced from patent WO 2019049061 A1[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
