| Cas No.: | 2452396-89-1 |
| Chemical Name: | Cyclopropanecarboxamide, N -[(2R ,3S )-1-[1-(4-fluorophenyl)-1H -indazol-5-yl]-4,4-dimethyl-5-oxo-2-phenyl-3-pyrrolidinyl]- (ACI) |
| SMILES: | N(C(=O)C1CC1)[C@@H]2[C@](N(C(=O)C2(C)C)C=3C=C4C(=CC3)N(N=C4)C5=CC=C(F)C=C5)(C6=CC=CC=C6)[H] |
| Formula: | C29H27FN4O2 |
| M.Wt: | 482.55 |
| Purity: | >98% |
| Sotrage: | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Publication: | Substituted pyrrolidine amides as glucocorticoid receptor modulators and their preparation By: Jakob, Florian; Alen, Jo; Krueger, Sebastian; Friebe, Daniela; Hennen, Stephanie; Barbie, Philipp World Intellectual Property Organization, WO2020144375 A1 2020-07-16 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
