| Cas No.: | 71748-57-7 |
| Chemical Name: | 4-Keto 13-cis-Retinoic Acid Methyl Ester |
| Synonyms: | 4-Keto 13-cis-Retinoic Acid Methyl Ester;4-KETO 13-CIS-RETINOIC ACID;methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate;13-cis-4-Oxo-retinoic acid Methyl Ester;4-oxo-(E)-methylretinoate;4-Oxo-retinoic acid methyl ester;Methyl 13-cis-4-Oxoretinoate;methyl 4-oxo-retinoate;Methyl-4-oxo-retinoat;Methyl-all-trans-4-oxo-retinoat |
| SMILES: | COC(/C=C(/C=C/C=C(/C=C/C1=C(C)C(=O)CCC1(C)C)\C)\C)=O |
| Formula: | C21O3H28 |
| M.Wt: | 328.4452 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Methyl 13-cis-4-Oxoretinoate is a bioactive chemical. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
