| Cas No.: | 7698-93-3 |
| Chemical Name: | beta-Estradiol 17-hemisuccinate |
| Synonyms: | Estra-1,3,5(10)-triene-3,17b-diol 17-hemisuccinate |
| SMILES: | OC(=O)CCC(=O)OC1C2(C)C(CC1)C3C(CC2)C4=C(C=C(O)C=C4)CC3 |
| Formula: | C22H28O5 |
| M.Wt: | 372.45472 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
