| Cas No.: | 122520-85-8 |
| Chemical Name: | 2-Propenamide,2-cyano-3-(3,4-dihydroxyphenyl)-, (2E)- |
| Synonyms: | 2-Propenamide,2-cyano-3-(3,4-dihydroxyphenyl)-, (2E)-;AG 99;AG-99;(E)-2-CYANO-3-(3,4-DIHYDROXYPHENYL)-2-PROPENAMIDE;3,4-DIHYDROXY-ALPHA-CYANOCINNAMIDE;ALPHA-CYANO-(3,4-DIHYDROXY)CINNAMIDE;TYRPHOSTIN 46;TYRPHOSTIN A46;TYRPHOSTIN AG 99;TYRPHOSTIN B40;(E)-2-Cyano-3-(3,4-dihydroxyphenyl)acrylamide;(E)-2-Cyano-3-(3,4-dihydroxyphenyl)propenamide;TYRPHOSTIN A46 99%;(E)-AG 99 |
| SMILES: | O=C(N)/C(C#N)=C/C1=CC=C(O)C(O)=C1 |
| Formula: | C10H8N2O3 |
| M.Wt: | 204.18212 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | (E)-AG 99 ((E)-Tyrphostin 46; (E)-Tyrphostin AG 99) is a potent EGFR inhibitor[1]. |
| References: | (E)-AG 99 ((E)-Tyrphostin 46; (E)-Tyrphostin AG 99) is a potent EGFR inhibitor[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
