| Cas No.: | 2820336-67-0 |
| Chemical Name: | JBJ-09-063 |
| Synonyms: | 2H-Isoindole-2-acetamide, α-(5-fluoro-2-hydroxyphenyl)-1,3-dihydro-6-[4-(1-methyl-4-piperidinyl)phenyl]-1-oxo-N-2-thiazolyl-;JBJ-09-063 |
| SMILES: | C(C1C=C(F)C=CC=1O)(N1CC2=CC=C(C3C=CC(C4CCN(C)CC4)=CC=3)C=C2C1=O)C(=O)NC1SC=CN=1 |
| Formula: | C31H29FN4O3S |
| M.Wt: | 556.650369405746 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
