| Cas No.: | 1698024-73-5 |
| Chemical Name: | ARS-1323 |
| Synonyms: | ARS-1323;ARS1323;ARS 1323;CPD2015;2-Propen-1-one, 1-[4-[6-chloro-8-fluoro-7-(2-fluoro-6-hydroxyphenyl)-4-quinazolinyl]-1-piperazinyl]-;Inhibitor,Ras,ARS1323,ARS 1323,inhibit,ARS-1323 |
| SMILES: | C(N1CCN(C2=C3C(=NC=N2)C(F)=C(C2=C(O)C=CC=C2F)C(Cl)=C3)CC1)(=O)C=C |
| Formula: | C21H17ClF2N4O2 |
| M.Wt: | 430.835090398788 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ARS-1323 is a novel inhibitor of mutant K-ras G12C extracted from patent WO 2015054572 A1. |
| References: | [1]. Liansheng Li, et al. Inhibitors of kras g12c. WO 2015054572 A1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
