| Cas No.: | 2750570-55-7 |
| Chemical Name: | BI-0474 |
| Synonyms: | Benzo[b]thiophene-3-carbonitrile, 2-amino-4-[3-[6-[(2S)-2,4-dimethyl-1-piperazinyl]-4-[4-(1-oxo-2-propen-1-yl)-1-piperazinyl]-2-pyridinyl]-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-4-methyl-, (4S)-;BI-0474 |
| SMILES: | C12CCC[C@@](C3ON=C(C4=NC(N5CCN(C)C[C@@H]5C)=CC(N5CCN(C(=O)C=C)CC5)=C4)N=3)(C)C=1C(C#N)=C(N)S2 |
| Formula: | C30H37N9O2S |
| M.Wt: | 587.738883733749 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
