| Cas No.: | 1449578-65-7 |
| SMILES: | O=C(C1=CC(CCC)=C(C)S1)N[C@H](CC2=CC=C(C3=CC=CC(OC(F)(F)F)=C3)N=C2)C(N[C@H]4CNCC4)=O |
| Formula: | C28H31F3N4O3S |
| M.Wt: | 560.63 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | In Vitro AZ82 is shown to specifically induce multipolar spindles in BT-549 cells, but not in cancer cells with normal centrosome number, such as HeLa. AZ82 binds specifically to KIFC1/MT complex but not to KIFC1 or MT alone. Treatment with AZ82 caused centrosome declustering in BT-549 breast cancer cells with amplified centrosomes. AZ82 inhibits both processes with an IC50 of 0.90 ± 0.09 μM for mant-ATP binding and 1.26 ± 0.51 μM for mant-ADP releasing. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
