| Cas No.: | 102029-68-5 |
| Chemical Name: | Adenosine 5′-monophosphoramidate sodium |
| SMILES: | O[C@H]([C@@H]1O)[C@](O[C@@H]1CO[P](N)(O[Na])=O)([H])N2C3=NC=NC(N)=C3N=C2 |
| Formula: | C10H14N6NaO6P |
| M.Wt: | 368.22 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
