| Cas No.: | 1129403-56-0 |
| Chemical Name: | Amcasertib |
| Synonyms: | AMCASERTIB;BBI503;Amcasertib (BBI503);s8572;A16850;N-[2-(Diethylamino)ethyl]-2,4-dimethyl-5-[(E)-[2-oxo-5-(2-phenyl-1,3-thiazol-4-yl)-1H-indol-3-yliden;Amcasertib |
| SMILES: | S1C(C2C([H])=C([H])C([H])=C([H])C=2[H])=NC(=C1[H])C1C([H])=C([H])C2=C(C=1[H])/C(/C(N2[H])=O)=C(/[H])\C1=C(C([H])([H])[H])C(C(N([H])C([H])([H])C([H])([H])N(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])[H])=O)=C(C([H])([H])[H])N1[H] |
| Formula: | C31H33N5O2S |
| M.Wt: | 539.6910 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Amcasertib is an orally administered investigational agent designed to inhibit cancer stem cell pathways, including Nanog, by targeting stemness kinases. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
