| Cas No.: | 1631164-24-3 |
| Chemical Name: | Chembl4537788 |
| Synonyms: | BAY1214784;(2S)-N-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methyl]-2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-1',1'-dioxospiro[2H-indole-3,4'-thiane]-5-carboxamide;Chembl4537788 |
| SMILES: | ClC1C([H])=C(C(F)(F)F)C([H])=NC=1C([H])([H])N([H])C(C1C([H])=C([H])C2=C(C=1[H])C1(C([H])([H])C([H])([H])S(C([H])([H])C1([H])[H])(=O)=O)[C@]([H])(C1([H])C([H])([H])C1([H])[H])N2S(C1C([H])=C([H])C(=C([H])C=1[H])F)(=O)=O)=O |
| Formula: | C29H26ClF4N3O5S2 |
| M.Wt: | 672.1105 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
