| Cas No.: | 4929-23-1 |
| Chemical Name: | BI-0115 |
| Synonyms: | BI-0115,BI 0115,BI0115,9-Chloro-5,11-dihydro-5-propyl-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES: | ClC1C=C2C(C(=O)N(CCC)C3C(=NC=CC=3)N2)=CC=1 |
| Formula: | C15H14ClN3O |
| M.Wt: | 287.74 |
| Purity: | >98% |
| Sotrage: | -20 |
| Description: | BI-0115 is a selective small molecule inhibitor of LOX-1 that blocks cellular uptake of oxLDL. BI-0115 binding triggers receptor inhibition by formation of dimers of the homodimeric ligand binding domain. The structure of LOX-1 bound to BI-0115 shows that inter-ligand interactions at the receptor interfaces are key to the formation of the receptor tetramer thereby blocking oxLDL binding. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
