| Cas No.: | 7461-38-3 |
| Chemical Name: | 4-chloro-N,N-diethylbenzamide |
| Synonyms: | 4-chloro-N,N-diethylbenzamide;4-(Et2NOC)C6H4Cl;4-chloro-N,N-diethyl-benzamide;AC1L85KS;KB-110954;N,N-diethyl-4-chlorobenzamide;NSC404988;p-ClC6H4C(O)NEt2;p-ClC6H4CONEt2;p-Et2NC(O)C6H4Cl |
| SMILES: | CCN(CC)C(=O)C1=CC=C(C=C1)Cl |
| Formula: | C11NOClH14 |
| M.Wt: | 211.688 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
