| Cas No.: | 1420071-30-2 |
| Chemical Name: | Bioymifi |
| Synonyms: | Bioymifi;1H-Isoindole-1,3(2H)-dione, 5-[5-[[3-(4-broMophenyl)-2-iMino-4-oxo-5-thiazolidinylidene]Methyl]-2-furanyl]-;DR5 Activator;(Z)-5-(5-[(3-[4-Bromophenyl]-2-imino-4-oxothiazolidin-5-ylidene)methyl]furan-2-yl)isoindoline-1,3-dione |
| SMILES: | O=C(/C(SC1=N)=C/C2=CC=C(O2)C3=CC(C(N4)=O)=C(C=C3)C4=O)N1C5=CC=C(C=C5)Br |
| Formula: | C22H12BrN3O4S |
| M.Wt: | 494.3173828125 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Bioymifi(DR5 Activator) is the first novel and potent small-molecule activatior of the TRAIL receptor DR5 in human cancer cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
