| Cas No.: | 151533-22-1 |
| Chemical Name: | Levomefolate calcium |
| Synonyms: | BAY 86-7660; BAY-86-7660; BAY86-7660; BAY 867660; BAY-867660; BAY867660; Levomefolate calcium; LMCA; Bodyfolin, Deplin; L-Methylfolate calcium; Levomefolate calcium; Levomefolinate calcium |
| SMILES: | NC1NC(=O)C2=C(NCC(CNC3C=CC(C(NC(CCC(O)=O)C([O-])=O)=O)=CC=3)N2C)N=1.[Ca+2].NC1NC(=O)C2=C(NCC(CNC3C=CC(C(NC(CCC(O)=O)C([O-])=O)=O)=CC=3)N2C)N=1 |
| Formula: | C20H23CaN7O6 |
| M.Wt: | 497.52 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
