| Cas No.: | 115453-99-1 |
| Chemical Name: | CB-7921220 |
| Synonyms: | CB-7921220 |
| SMILES: | O=C(C1=NC(/C=C/C2=CC=C(N)C=C2)=CC=C1)O |
| Formula: | C14H12N2O2 |
| M.Wt: | 240.257283210754 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | CB-7921220 is an adenylate cyclase inhibitor. |
| In Vitro: | CB-7921220 shows a degree of isoform selectivity for adenylate cyclase (AC) 1, but cannot distinguish between AC1 and AC6. CB-7921220 has a more consistent predicted binding position in the two virtual docking screens, and has a binding conformation similar to ATP and P-site inhibitors, which may explain its lack of selectivity between AC1 and AC6[1]. |
| References: | [1]. Brand CS, et al. Isoform selectivity of adenylyl cyclase inhibitors: characterization of known and novel compounds. J Pharmacol Exp Ther. 2013 Nov;347(2):265-75. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
