| Cas No.: | 1706738-98-8 |
| Chemical Name: | Unii-K424WH3WU0 |
| Synonyms: | K424WH3WU0;Trotabresib;Trotabresib [USAN];BDBM285044;US10023592, Example 89;QC5487;WHO 11839;Cn1cc(-c2cc(ccc2OCC2CC2)S(C)(=O)=O)c2ccccc2c1=O;4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one;1(2H)-Isoquinolinone, 4-(2-(cyclopropylmethoxy)-5-(methylsulfonyl)phenyl)-2-methyl-;4-(2-(cyclopropylmethoxy)-5-(methylsulfonyl)phenyl)-2-methylisoquinolin-1(2H)-one;4-[2-(cyclopropylmethoxy)- 5-methylsulfonylphenyl]-2- ;Unii-K424WH3WU0;CC-90010 |
| SMILES: | S(C([H])([H])[H])(C1C([H])=C([H])C(=C(C=1[H])C1=C([H])N(C([H])([H])[H])C(C2=C([H])C([H])=C([H])C([H])=C12)=O)OC([H])([H])C1([H])C([H])([H])C1([H])[H])(=O)=O |
| Formula: | C21H21NO4S |
| M.Wt: | 383.4607 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Description: | CC-90010 (compound 1) is a reversible and orally active BET inhibitor. CC-90010 is applied in the study for advanced solid tumors |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
