| Cas No.: | 173352-21-1 |
| Chemical Name: | CM 346 |
| Synonyms: | CM 346;4-[2-[(6-ethoxy-1h-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;CM-346;Obenoxazine HCl;4-(2-(5-ETHOXY-1H-BENZO[D]IMIDAZOL-2-YLTHIO)ETHYL)MORPHOLINE;6-Ethoxy-2-[[2-(4-morpholinyl)ethyl]thio]-1H-benzimidazole;Afobazol;Afobazole;Aphobazole;Fabomotizole;Obenoxazine;CM 346(Obenoxazine);Obenoxazine hydrochloride;CM 346 4-(2-(5-ETHOXY-1H-BENZO[D]IMIDAZOL-2-YLTHIO)ETHYL)MORPHOLINE |
| SMILES: | CCOC1=CC=C2C(N=C(SCCN3CCOCC3)N2)=C1 |
| Formula: | C15H21N3O2S |
| M.Wt: | 307.41114 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Fabomotizole (CM346) is an anxiolytic drug; produces anxiolytic and neuroprotective effects without any sedative or muscle relaxant actions. |
| References: | [1]. Afobazole, From Wikipedia |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
