| Cas No.: | 1798871-31-4 |
| SMILES: | CC1=CC(=NN1)NC2=NC(=NC(=C2OC)N3CCCCC3)SC4=C(C=C(C=C4)S(=O)(=O)CC5=C(C(=CC=C5)[N+](=O)[O-])F)F |
| Formula: | C27H27F2N7O5S2 |
| M.Wt: | 631.67 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Centrinone-B is a high affinity and selective PLK4 inhibitor (Ki = 0.59 nM). Centrinone-B is a selective and reversible inhibitor of polo-like kinase 4 (Plk4). Centrinone-B exhibits >2000-fold selectivity for PLK4 over Aurora A and Aurora B. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
