| Cas No.: | 1204317-86-1 |
| Chemical Name: | N-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl]-2-hydroxybenzamide |
| Synonyms: | CAT-1004;CAT1004 |
| SMILES: | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNC(=O)C1=CC=CC=C1O |
| Formula: | C31H42N2O3 |
| M.Wt: | 490.688 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Edasalonexent (CAT-1004) is a bifunctional, orally administered small molecule that covalently links 2 compounds known to inhibit NF‐κB, salicylic acid and docosahexaenoic acid (DHA); significantly inhibits NF-κB p65-dependent inflammatory responses as well as downstream proinflammatory genes modulated by p65 in the golden retriever DMD model; Edasalonexent is hydrolyzed by FAAH to release salicylic acid and DHA intracellularly and to suppress activated NF-κB. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
