| Cas No.: | 443144-27-2 |
| Chemical Name: | 7-[[4-[2-(4-Fluorophenyl)ethyl]-1-piperazinyl]carbonyl]-1H-indole-3-carbonitrile hydrochloride |
| Synonyms: | EMD281014 |
| SMILES: | N1C2=C(C=CC=C2C(N2CCN(CCC3=CC=C(F)C=C3)CC2)=O)C(C#N)=C1.[H]Cl |
| Formula: | C22H22ClFN4O |
| M.Wt: | 412.893 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | EMD-281014 hydrochloride is a potent, highly selective 5-HT2A antagonist with Ki of 0.87 nM, displays little to no affinity for 5-HT2C receptors (Ki=557 nM), human D2 receptors and IKr channels; significantly increases swimming and decreases immobility in male congenital learned helpless rats in the forced swim test; reduces dyskinesia and psychosis in the l-DOPA-treated parkinsonian marmoset. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
