| Cas No.: | 613-11-6 |
| Chemical Name: | 3,7-bis(dimethylamino)phenothiazin-5-ium |
| Synonyms: | Hydromethylthionine;Methylene blue |
| SMILES: | C1C2=C([S+]=C3C(=N2)C=CC(N(C)C)=C3)C=C(N(C)C)C=1 |
| Formula: | C16H19N3S |
| M.Wt: | 285.40716 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | TRX-0237 Methylate (Hydromethylthionine, Methylene blue) is a Tau aggregation inhibitor (TAI) with Ki of 0.12 uM for intracellular TAI activity; disrupts paired helical filaments (PHFs) isolated from AD brain tissues at 0.16 uM, delays cellular senescence and enhances key mitochondrial biochemical pathways; demonstrates activities in clinical trials in Alzheimer's disease (AD) with drugs targeting β-amyloid accumulation in the brain. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
