| Cas No.: | 1892594-93-2 |
| Chemical Name: | 2-methyl-2-((4-oxo-1-phenyl-4,5-dihydro-1H-pyrazolo[3,4-d]pyrimidin-6-yl)thio)propanamide |
| Synonyms: | DAPK3 inhibitor HS94 |
| SMILES: | C(N)(=O)C(C)(SC1NC(=O)C2C=NN(C3=CC=CC=C3)C=2N=1)C |
| Formula: | C15H15N5O2S |
| M.Wt: | 329.378 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | HS94 (DAPK3 inhibitor HS94) is a selective DAPK3 inhibitor with Ki of 126 nM, >20-fold selectivity over Pim kinases. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
