| Cas No.: | 1425049-20-2 |
| Chemical Name: | 1-(4-octylphenethyl)piperidin-4-ol |
| Synonyms: | RB005 |
| SMILES: | N(CCC1=CC=C(CCCCCCCC)C=C1)1CCC(O)CC1 |
| Formula: | C21H35NO |
| M.Wt: | 317.517 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | RB-005 (RB-005) is a potent, selective inhibitor of sphingosine kinase SphK1 (SK1) with IC50 of 3.6 uM, displays 15-fold selectivity over SphK2. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
