| Cas No.: | 188181-42-2 |
| Chemical Name: | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (E)-octadec-9-enoate |
| Synonyms: | CP-4055;CP4055 |
| SMILES: | C(OC[C@H]1[C@H](O)[C@@H](O)[C@@H](N2C(=O)N=C(N)C=C2)O1)(=O)CCCCCCC/C=C/CCCCCCCC |
| Formula: | C27H45N3O6 |
| M.Wt: | 507.672 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Elacytarabine (CP-4055, CP4055) is a fatty acid derivative of cytarabine with potential antineoplastic activity; CP-4055 is converted intracellularly into cytarabine triphosphate by deoxycytidine kinase and subsequently competes with cytidine for incorporation into DNA, thereby inhibiting DNA synthesis. Compared to cytarabine, CP-4055 shows increased cellular uptake and retention, resulting in increased activation by deoxycytidine kinase to cytarabine triphosphate, decreased deamination and deactivation by deoxycytidine deaminase, and increased inhibition of DNA synthesis. This agent also inhibits RNA synthesis, an effect not seen with cytarabine. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
